C20H25NOS — CID 141041802
(2S)-4-phenyl-1-[(3R)-3-phenylsulfanylpyrrolidin-1-yl]butan-2-ol (PubChem CID 141041802) has the molecular formula C20H25NOS and a molecular weight of 327.49 g/mol. Its IUPAC name is (2S)-4-phenyl-1-[(3R)-3-phenylsulfanylpyrrolidin-1-yl]butan-2-ol.
| Compound Name | (2S)-4-phenyl-1-[(3R)-3-phenylsulfanylpyrrolidin-1-yl]butan-2-ol |
|---|---|
| PubChem CID | 141041802 |
| Molecular Formula | C20H25NOS |
| Molecular Weight | 327.49 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (2S)-4-phenyl-1-[(3R)-3-phenylsulfanylpyrrolidin-1-yl]butan-2-ol |
| SMILES | O[C@@H](CCc1ccccc1)CN1CC[C@@H](Sc2ccccc2)C1 |
| InChI | InChI=1S/C20H25NOS/c22-18(12-11-17-7-3-1-4-8-17)15-21-14-13-20(16-21)23-19-9-5-2-6-10-19/h1-10,18,20,22H,11-16H2/t18-,20+/m0/s1 |
| InChIKey | DPDYTRYZQQEBAD-AZUAARDMSA-N |
| XLogP | 3.85 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |