C25H30O3 — CID 14104246
(2R,4R)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-ethenyl-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one (PubChem CID 14104246) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is (2R,4R)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-ethenyl-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one.
| Compound Name | (2R,4R)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-ethenyl-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one |
|---|---|
| PubChem CID | 14104246 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (2R,4R)-2-[(1E)-2,6-dimethylhepta-1,5-dienyl]-4-ethenyl-4,10-dimethyl-2,3-dihydropyrano[3,2-c]chromen-5-one |
| SMILES | C=C[C@@]1(C)C[C@H](/C=C(\C)CCC=C(C)C)Oc2c1c(=O)oc1cccc(C)c21 |
| InChI | InChI=1S/C25H30O3/c1-7-25(6)15-19(14-17(4)11-8-10-16(2)3)27-23-21-18(5)12-9-13-20(21)28-24(26)22(23)25/h7,9-10,12-14,19H,1,8,11,15H2,2-6H3/b17-14+/t19-,25-/m0/s1 |
| InChIKey | CZZAJXDYJLEVJF-VQDZCXJYSA-N |
| XLogP | 6.39 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|