C36H6BF17O2 — CID 141042502
(2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)oxy-(2,3,4,5,6-pentafluoropyren-1-yl)-(2,3,6-trifluorophenoxy)borane (PubChem CID 141042502) has the molecular formula C36H6BF17O2 and a molecular weight of 804.22 g/mol. Its IUPAC name is (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)oxy-(2,3,4,5,6-pentafluoropyren-1-yl)-(2,3,6-trifluorophenoxy)borane.
| Compound Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)oxy-(2,3,4,5,6-pentafluoropyren-1-yl)-(2,3,6-trifluorophenoxy)borane |
|---|---|
| PubChem CID | 141042502 |
| Molecular Formula | C36H6BF17O2 |
| Molecular Weight | 804.22 g/mol |
| Exact Mass | 804.02 |
| IUPAC Name | (2,3,4,5,6,7,8,9,10-nonafluoroanthracen-1-yl)oxy-(2,3,4,5,6-pentafluoropyren-1-yl)-(2,3,6-trifluorophenoxy)borane |
| SMILES | Fc1ccc(F)c(OB(Oc2c(F)c(F)c(F)c3c(F)c4c(F)c(F)c(F)c(F)c4c(F)c23)c2c(F)c(F)c3c(F)c(F)c4c(F)ccc5ccc2c3c54)c1F |
| InChI | InChI=1S/C36H6BF17O2/c38-9-4-2-7-1-3-8-13-12(7)14(9)24(44)25(45)15(13)26(46)30(50)20(8)37(55-35-11(40)6-5-10(39)21(35)41)56-36-19-18(29(49)33(53)34(36)54)22(42)16-17(23(19)43)28(48)32(52)31(51)27(16)47/h1-6H |
| InChIKey | GAMNUUZLEOBNAL-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.22 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|