C25H28O4 — CID 14104260
(2E,6E)-7-[(2R,4S)-4-ethenyl-4,6-dimethyl-5-oxo-2,3-dihydropyrano[2,3-b]chromen-2-yl]-2,6-dimethylhepta-2,6-dienal (PubChem CID 14104260) has the molecular formula C25H28O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is (2E,6E)-7-[(2R,4S)-4-ethenyl-4,6-dimethyl-5-oxo-2,3-dihydropyrano[2,3-b]chromen-2-yl]-2,6-dimethylhepta-2,6-dienal.
| Compound Name | (2E,6E)-7-[(2R,4S)-4-ethenyl-4,6-dimethyl-5-oxo-2,3-dihydropyrano[2,3-b]chromen-2-yl]-2,6-dimethylhepta-2,6-dienal |
|---|---|
| PubChem CID | 14104260 |
| Molecular Formula | C25H28O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | (2E,6E)-7-[(2R,4S)-4-ethenyl-4,6-dimethyl-5-oxo-2,3-dihydropyrano[2,3-b]chromen-2-yl]-2,6-dimethylhepta-2,6-dienal |
| SMILES | C=C[C@]1(C)C[C@H](/C=C(\C)CC/C=C(\C)C=O)Oc2oc3cccc(C)c3c(=O)c21 |
| InChI | InChI=1S/C25H28O4/c1-6-25(5)14-19(13-16(2)9-7-10-17(3)15-26)28-24-22(25)23(27)21-18(4)11-8-12-20(21)29-24/h6,8,10-13,15,19H,1,7,9,14H2,2-5H3/b16-13+,17-10+/t19-,25+/m0/s1 |
| InChIKey | GBIHCVINTFQKQS-ZZPPWLRRSA-N |
| XLogP | 5.57 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|