C16H16O4 — CID 14104268
2,5-dimethoxy-9,10-dihydrophenanthrene-1,7-diol (PubChem CID 14104268) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is 2,5-dimethoxy-9,10-dihydrophenanthrene-1,7-diol.
| Compound Name | 2,5-dimethoxy-9,10-dihydrophenanthrene-1,7-diol |
|---|---|
| PubChem CID | 14104268 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2,5-dimethoxy-9,10-dihydrophenanthrene-1,7-diol |
| SMILES | COc1ccc2c(c1O)CCc1cc(O)cc(OC)c1-2 |
| InChI | InChI=1S/C16H16O4/c1-19-13-6-5-11-12(16(13)18)4-3-9-7-10(17)8-14(20-2)15(9)11/h5-8,17-18H,3-4H2,1-2H3 |
| InChIKey | YSSFIGREEVEYNI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |