About 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid
1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 141043063) has the molecular formula C17H22O7
and a molecular weight of 338.36 g/mol. Its IUPAC name is 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 141043063 |
| Molecular Formula | C17H22O7 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | C=CC(=O)OCCC1=C(C)C=CC(C(=O)OCCC)C1(O)C(=O)O |
| InChI | InChI=1S/C17H22O7/c1-4-9-24-15(19)13-7-6-11(3)12(17(13,22)16(20)21)8-10-23-14(18)5-2/h5-7,13,22H,2,4,8-10H2,1,3H3,(H,20,21) |
| InChIKey | AWUOYDJAMLVXCR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid (CID 141043063) is 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid is C=CC(=O)OCCC1=C(C)C=CC(C(=O)OCCC)C1(O)C(=O)O.
What is the InChIKey of 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is AWUOYDJAMLVXCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O7/c1-4-9-24-15(19)13-7-6-11(3)12(17(13,22)16(20)21)8-10-23-14(18)5-2/h5-7,13,22H,2,4,8-10H2,1,3H3,(H,20,21).
What are the key properties of 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid?
1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 338.36 g/mol, XLogP of 1.38, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-3-methyl-2-(2-prop-2-enoyloxyethyl)-6-propoxycarbonylcyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 141043063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).