C20H17NO7 — CID 141043146
(E)-3-[3,4-dimethoxy-2-[5-nitro-2-[(E)-3-oxoprop-1-enyl]phenyl]phenyl]prop-2-enoic acid (PubChem CID 141043146) has the molecular formula C20H17NO7 and a molecular weight of 383.36 g/mol. Its IUPAC name is (E)-3-[3,4-dimethoxy-2-[5-nitro-2-[(E)-3-oxoprop-1-enyl]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,4-dimethoxy-2-[5-nitro-2-[(E)-3-oxoprop-1-enyl]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 141043146 |
| Molecular Formula | C20H17NO7 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | (E)-3-[3,4-dimethoxy-2-[5-nitro-2-[(E)-3-oxoprop-1-enyl]phenyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(/C=C/C(=O)O)c(-c2cc([N+](=O)[O-])ccc2/C=C/C=O)c1OC |
| InChI | InChI=1S/C20H17NO7/c1-27-17-9-6-14(7-10-18(23)24)19(20(17)28-2)16-12-15(21(25)26)8-5-13(16)4-3-11-22/h3-12H,1-2H3,(H,23,24)/b4-3+,10-7+ |
| InChIKey | UKFAOVHYRJQLHE-YZQQHVNFSA-N |
| XLogP | 3.59 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|