C11H21N3O2 — CID 141043465
2-(1-methyl-5-propyl-1,2,4-triazol-3-yl)pentane-1,3-diol (PubChem CID 141043465) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-(1-methyl-5-propyl-1,2,4-triazol-3-yl)pentane-1,3-diol.
| Compound Name | 2-(1-methyl-5-propyl-1,2,4-triazol-3-yl)pentane-1,3-diol |
|---|---|
| PubChem CID | 141043465 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 2-(1-methyl-5-propyl-1,2,4-triazol-3-yl)pentane-1,3-diol |
| SMILES | CCCc1nc(C(CO)C(O)CC)nn1C |
| InChI | InChI=1S/C11H21N3O2/c1-4-6-10-12-11(13-14(10)3)8(7-15)9(16)5-2/h8-9,15-16H,4-7H2,1-3H3 |
| InChIKey | PMDDNCBHGGAWFK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |