About 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide
2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 141043599) has the molecular formula C10H11N3O2S
and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide.
Molecular Properties
| Compound Name | 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide |
| PubChem CID | 141043599 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C10H11N3O2S/c14-16(15)5-1-4-13(16)9-2-3-10-8(6-9)7-11-12-10/h2-3,6-7H,1,4-5H2,(H,11,12) |
| InChIKey | WJGHLTXXGHTQMZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide (CID 141043599) is 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide is O=S1(=O)CCCN1c1ccc2[nH]ncc2c1.
What is the InChIKey of 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
The InChIKey is WJGHLTXXGHTQMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2S/c14-16(15)5-1-4-13(16)9-2-3-10-8(6-9)7-11-12-10/h2-3,6-7H,1,4-5H2,(H,11,12).
What are the key properties of 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide?
2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide has a molecular weight of 237.28 g/mol, XLogP of 1.10, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-indazol-5-yl)-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 141043599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).