C20H21NO5 — CID 141043724
2-[2,3,4-trimethoxy-5-(5-methoxy-1H-indol-2-yl)phenyl]acetaldehyde (PubChem CID 141043724) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[2,3,4-trimethoxy-5-(5-methoxy-1H-indol-2-yl)phenyl]acetaldehyde.
| Compound Name | 2-[2,3,4-trimethoxy-5-(5-methoxy-1H-indol-2-yl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 141043724 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 2-[2,3,4-trimethoxy-5-(5-methoxy-1H-indol-2-yl)phenyl]acetaldehyde |
| SMILES | COc1ccc2[nH]c(-c3cc(CC=O)c(OC)c(OC)c3OC)cc2c1 |
| InChI | InChI=1S/C20H21NO5/c1-23-14-5-6-16-13(9-14)11-17(21-16)15-10-12(7-8-22)18(24-2)20(26-4)19(15)25-3/h5-6,8-11,21H,7H2,1-4H3 |
| InChIKey | AGIFPDRIHMKJJK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|