C9H6F3N3O — CID 141043951
8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 141043951) has the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 141043951 |
| Molecular Formula | C9H6F3N3O |
| Molecular Weight | 229.16 g/mol |
| Exact Mass | 229.05 |
| IUPAC Name | 8-(2,2,2-trifluoroethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | O=c1ccc2cncnc2n1CC(F)(F)F |
| InChI | InChI=1S/C9H6F3N3O/c10-9(11,12)4-15-7(16)2-1-6-3-13-5-14-8(6)15/h1-3,5H,4H2 |
| InChIKey | IQNNSAVTOBURSL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |