C23H21FN4O4 — CID 141044297
(4-nitrophenyl)methyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate (PubChem CID 141044297) has the molecular formula C23H21FN4O4 and a molecular weight of 436.44 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate.
| Compound Name | (4-nitrophenyl)methyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 141044297 |
| Molecular Formula | C23H21FN4O4 |
| Molecular Weight | 436.44 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | (4-nitrophenyl)methyl 4-[5-(2-fluorophenyl)-2-pyridinyl]piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccc([N+](=O)[O-])cc1)N1CCN(c2ccc(-c3ccccc3F)cn2)CC1 |
| InChI | InChI=1S/C23H21FN4O4/c24-21-4-2-1-3-20(21)18-7-10-22(25-15-18)26-11-13-27(14-12-26)23(29)32-16-17-5-8-19(9-6-17)28(30)31/h1-10,15H,11-14,16H2 |
| InChIKey | ZYYSLVFOZLZKPJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|