About [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate
[2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate (PubChem CID 141044471) has the molecular formula C15H8N3O2PS2
and a molecular weight of 357.36 g/mol. Its IUPAC name is [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate.
Molecular Properties
| Compound Name | [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate |
| PubChem CID | 141044471 |
| Molecular Formula | C15H8N3O2PS2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 356.98 |
| IUPAC Name | [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate |
| SMILES | N#CSc1cc(OC#P=O)c2nc(N)sc2c1-c1ccccc1 |
| InChI | InChI=1S/C15H8N3O2PS2/c16-7-22-11-6-10(20-8-21-19)13-14(23-15(17)18-13)12(11)9-4-2-1-3-5-9/h1-6H,(H2,17,18) |
| InChIKey | JGVIRJHSEFDQHM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 89.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate?
The IUPAC name of [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate (CID 141044471) is [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate.
What is the SMILES notation for [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate?
The canonical SMILES for [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate is N#CSc1cc(OC#P=O)c2nc(N)sc2c1-c1ccccc1.
What is the InChIKey of [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate?
The InChIKey is JGVIRJHSEFDQHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8N3O2PS2/c16-7-22-11-6-10(20-8-21-19)13-14(23-15(17)18-13)12(11)9-4-2-1-3-5-9/h1-6H,(H2,17,18).
What are the key properties of [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate?
[2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate has a molecular weight of 357.36 g/mol, XLogP of 4.71, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-amino-4-[(oxo-λ5-phosphanylidyne)methoxy]-7-phenyl-1,3-benzothiazol-6-yl] thiocyanate is sourced from PubChem (CID 141044471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).