C13H21NO6 — CID 14104455
1-O-tert-butyl 2-O,5-O-dimethyl pyrrolidine-1,2,5-tricarboxylate (PubChem CID 14104455) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O,5-O-dimethyl pyrrolidine-1,2,5-tricarboxylate.
| Compound Name | 1-O-tert-butyl 2-O,5-O-dimethyl pyrrolidine-1,2,5-tricarboxylate |
|---|---|
| PubChem CID | 14104455 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-O-tert-butyl 2-O,5-O-dimethyl pyrrolidine-1,2,5-tricarboxylate |
| SMILES | COC(=O)C1CCC(C(=O)OC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21NO6/c1-13(2,3)20-12(17)14-8(10(15)18-4)6-7-9(14)11(16)19-5/h8-9H,6-7H2,1-5H3 |
| InChIKey | IBFGGAQUXJGPAC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|