C19H21F7OSi — CID 141045109
(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane (PubChem CID 141045109) has the molecular formula C19H21F7OSi and a molecular weight of 426.45 g/mol. Its IUPAC name is (1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane.
| Compound Name | (1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 141045109 |
| Molecular Formula | C19H21F7OSi |
| Molecular Weight | 426.45 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | (1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](Oc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H21F7OSi/c1-7(2)28(8(3)4,9(5)6)27-19-15(23)11-10(14(22)18(19)26)12(20)16(24)17(25)13(11)21/h7-9H,1-6H3 |
| InChIKey | DOMNSMVRNJMOMI-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.45 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|