C26H35F7OSi2 — CID 141045137
cyclohexyl-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-propan-2-yl-(triethylsilylmethyl)silane (PubChem CID 141045137) has the molecular formula C26H35F7OSi2 and a molecular weight of 552.72 g/mol. Its IUPAC name is cyclohexyl-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-propan-2-yl-(triethylsilylmethyl)silane.
| Compound Name | cyclohexyl-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-propan-2-yl-(triethylsilylmethyl)silane |
|---|---|
| PubChem CID | 141045137 |
| Molecular Formula | C26H35F7OSi2 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.21 |
| IUPAC Name | cyclohexyl-(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-propan-2-yl-(triethylsilylmethyl)silane |
| SMILES | CC[Si](CC)(CC)C[Si](Oc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C26H35F7OSi2/c1-6-35(7-2,8-3)14-36(15(4)5,16-12-10-9-11-13-16)34-26-22(30)18-17(21(29)25(26)33)19(27)23(31)24(32)20(18)28/h15-16H,6-14H2,1-5H3 |
| InChIKey | NOUVTQYAZMCQFA-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|