C27H39F7OSi2 — CID 141045162
cyclohexyl-(1,1,2,3,4,6,7-heptafluoroinden-5-yl)oxy-propan-2-yl-(3-triethylsilylpropyl)silane (PubChem CID 141045162) has the molecular formula C27H39F7OSi2 and a molecular weight of 568.77 g/mol. Its IUPAC name is cyclohexyl-(1,1,2,3,4,6,7-heptafluoroinden-5-yl)oxy-propan-2-yl-(3-triethylsilylpropyl)silane.
| Compound Name | cyclohexyl-(1,1,2,3,4,6,7-heptafluoroinden-5-yl)oxy-propan-2-yl-(3-triethylsilylpropyl)silane |
|---|---|
| PubChem CID | 141045162 |
| Molecular Formula | C27H39F7OSi2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | cyclohexyl-(1,1,2,3,4,6,7-heptafluoroinden-5-yl)oxy-propan-2-yl-(3-triethylsilylpropyl)silane |
| SMILES | CC[Si](CC)(CC)CCC[Si](Oc1c(F)c(F)c2c(c1F)C(F)=C(F)C2(F)F)(C(C)C)C1CCCCC1 |
| InChI | InChI=1S/C27H39F7OSi2/c1-6-36(7-2,8-3)15-12-16-37(17(4)5,18-13-10-9-11-14-18)35-25-21(28)19-20(23(30)24(25)31)27(33,34)26(32)22(19)29/h17-18H,6-16H2,1-5H3 |
| InChIKey | JWAWXOFTPBZRKI-UHFFFAOYSA-N |
| XLogP | 10.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | 10.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|