C21H21F9OSi — CID 141045170
tri(propan-2-yl)-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silane (PubChem CID 141045170) has the molecular formula C21H21F9OSi and a molecular weight of 488.47 g/mol. Its IUPAC name is tri(propan-2-yl)-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silane.
| Compound Name | tri(propan-2-yl)-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silane |
|---|---|
| PubChem CID | 141045170 |
| Molecular Formula | C21H21F9OSi |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | tri(propan-2-yl)-[2,3,4,6-tetrafluoro-5-(2,3,4,5,6-pentafluorophenyl)phenoxy]silane |
| SMILES | CC(C)[Si](Oc1c(F)c(F)c(F)c(-c2c(F)c(F)c(F)c(F)c2F)c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H21F9OSi/c1-7(2)32(8(3)4,9(5)6)31-21-15(25)11(14(24)18(28)20(21)30)10-12(22)16(26)19(29)17(27)13(10)23/h7-9H,1-6H3 |
| InChIKey | MDRNREBPMXEPIH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|