C34H53F7OSi2 — CID 141045207
(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-hexyl-propan-2-yl-(6-tripropylsilylhexyl)silane (PubChem CID 141045207) has the molecular formula C34H53F7OSi2 and a molecular weight of 666.96 g/mol. Its IUPAC name is (1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-hexyl-propan-2-yl-(6-tripropylsilylhexyl)silane.
| Compound Name | (1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-hexyl-propan-2-yl-(6-tripropylsilylhexyl)silane |
|---|---|
| PubChem CID | 141045207 |
| Molecular Formula | C34H53F7OSi2 |
| Molecular Weight | 666.96 g/mol |
| Exact Mass | 666.35 |
| IUPAC Name | (1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-hexyl-propan-2-yl-(6-tripropylsilylhexyl)silane |
| SMILES | CCCCCC[Si](CCCCCC[Si](CCC)(CCC)CCC)(Oc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)C(C)C |
| InChI | InChI=1S/C34H53F7OSi2/c1-7-11-12-16-22-44(24(5)6,23-17-14-13-15-21-43(18-8-2,19-9-3)20-10-4)42-34-30(38)26-25(29(37)33(34)41)27(35)31(39)32(40)28(26)36/h24H,7-23H2,1-6H3 |
| InChIKey | RSIVYSIRTWGSLI-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.96 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|