C25H35F7OSi2 — CID 141045215
triethyl-[3-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-di(propan-2-yl)silyl]propyl]silane (PubChem CID 141045215) has the molecular formula C25H35F7OSi2 and a molecular weight of 540.71 g/mol. Its IUPAC name is triethyl-[3-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-di(propan-2-yl)silyl]propyl]silane.
| Compound Name | triethyl-[3-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-di(propan-2-yl)silyl]propyl]silane |
|---|---|
| PubChem CID | 141045215 |
| Molecular Formula | C25H35F7OSi2 |
| Molecular Weight | 540.71 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | triethyl-[3-[(1,3,4,5,6,7,8-heptafluoronaphthalen-2-yl)oxy-di(propan-2-yl)silyl]propyl]silane |
| SMILES | CC[Si](CC)(CC)CCC[Si](Oc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H35F7OSi2/c1-8-34(9-2,10-3)12-11-13-35(14(4)5,15(6)7)33-25-21(29)17-16(20(28)24(25)32)18(26)22(30)23(31)19(17)27/h14-15H,8-13H2,1-7H3 |
| InChIKey | BUWGYQLYWDAIPW-UHFFFAOYSA-N |
| XLogP | 9.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.71 |
| LogP ≤ 5 | 9.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|