C26H36O2 — CID 141045507
2-benzyl-3-butan-2-yl-4-methyl-3-(2-phenylethyl)hexanoic acid (PubChem CID 141045507) has the molecular formula C26H36O2 and a molecular weight of 380.57 g/mol. Its IUPAC name is 2-benzyl-3-butan-2-yl-4-methyl-3-(2-phenylethyl)hexanoic acid.
| Compound Name | 2-benzyl-3-butan-2-yl-4-methyl-3-(2-phenylethyl)hexanoic acid |
|---|---|
| PubChem CID | 141045507 |
| Molecular Formula | C26H36O2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 2-benzyl-3-butan-2-yl-4-methyl-3-(2-phenylethyl)hexanoic acid |
| SMILES | CCC(C)C(CCc1ccccc1)(C(C)CC)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H36O2/c1-5-20(3)26(21(4)6-2,18-17-22-13-9-7-10-14-22)24(25(27)28)19-23-15-11-8-12-16-23/h7-16,20-21,24H,5-6,17-19H2,1-4H3,(H,27,28) |
| InChIKey | JIHGBAVFKWQQSQ-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |