About 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole
3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole (PubChem CID 141045947) has the molecular formula C16H15ClFNO
and a molecular weight of 291.75 g/mol. Its IUPAC name is 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole |
| PubChem CID | 141045947 |
| Molecular Formula | C16H15ClFNO |
| Molecular Weight | 291.75 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole |
| SMILES | COc1ccc(Cl)cc1C1(F)CNc2ccc(C)cc21 |
| InChI | InChI=1S/C16H15ClFNO/c1-10-3-5-14-12(7-10)16(18,9-19-14)13-8-11(17)4-6-15(13)20-2/h3-8,19H,9H2,1-2H3 |
| InChIKey | VLKSDBJXRUZYKU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole?
The IUPAC name of 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole (CID 141045947) is 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole.
What is the SMILES notation for 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole?
The canonical SMILES for 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole is COc1ccc(Cl)cc1C1(F)CNc2ccc(C)cc21.
What is the InChIKey of 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole?
The InChIKey is VLKSDBJXRUZYKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClFNO/c1-10-3-5-14-12(7-10)16(18,9-19-14)13-8-11(17)4-6-15(13)20-2/h3-8,19H,9H2,1-2H3.
What are the key properties of 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole?
3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole has a molecular weight of 291.75 g/mol, XLogP of 4.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2-methoxyphenyl)-3-fluoro-5-methyl-1,2-dihydroindole is sourced from PubChem (CID 141045947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).