About 2-dimethylphosphanylnaphthalene-1,4-diol
2-dimethylphosphanylnaphthalene-1,4-diol (PubChem CID 141045981) has the molecular formula C12H13O2P
and a molecular weight of 220.21 g/mol. Its IUPAC name is 2-dimethylphosphanylnaphthalene-1,4-diol.
Molecular Properties
| Compound Name | 2-dimethylphosphanylnaphthalene-1,4-diol |
| PubChem CID | 141045981 |
| Molecular Formula | C12H13O2P |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 2-dimethylphosphanylnaphthalene-1,4-diol |
| SMILES | CP(C)c1cc(O)c2ccccc2c1O |
| InChI | InChI=1S/C12H13O2P/c1-15(2)11-7-10(13)8-5-3-4-6-9(8)12(11)14/h3-7,13-14H,1-2H3 |
| InChIKey | WTXKZZSRSZBBIG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylphosphanylnaphthalene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylphosphanylnaphthalene-1,4-diol?
The IUPAC name of 2-dimethylphosphanylnaphthalene-1,4-diol (CID 141045981) is 2-dimethylphosphanylnaphthalene-1,4-diol.
What is the SMILES notation for 2-dimethylphosphanylnaphthalene-1,4-diol?
The canonical SMILES for 2-dimethylphosphanylnaphthalene-1,4-diol is CP(C)c1cc(O)c2ccccc2c1O.
What is the InChIKey of 2-dimethylphosphanylnaphthalene-1,4-diol?
The InChIKey is WTXKZZSRSZBBIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13O2P/c1-15(2)11-7-10(13)8-5-3-4-6-9(8)12(11)14/h3-7,13-14H,1-2H3.
What are the key properties of 2-dimethylphosphanylnaphthalene-1,4-diol?
2-dimethylphosphanylnaphthalene-1,4-diol has a molecular weight of 220.21 g/mol, XLogP of 2.62, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylphosphanylnaphthalene-1,4-diol is sourced from PubChem (CID 141045981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).