About 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine
8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine (PubChem CID 141046225) has the molecular formula C7H11ClN4
and a molecular weight of 186.65 g/mol. Its IUPAC name is 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine.
Molecular Properties
| Compound Name | 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine |
| PubChem CID | 141046225 |
| Molecular Formula | C7H11ClN4 |
| Molecular Weight | 186.65 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine |
| SMILES | CN1C=C2NC(Cl)N=C2N(C)C1 |
| InChI | InChI=1S/C7H11ClN4/c1-11-3-5-6(12(2)4-11)10-7(8)9-5/h3,7,9H,4H2,1-2H3 |
| InChIKey | QIPWWTIBQVLNLU-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.65 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine?
The IUPAC name of 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine (CID 141046225) is 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine.
What is the SMILES notation for 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine?
The canonical SMILES for 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine is CN1C=C2NC(Cl)N=C2N(C)C1.
What is the InChIKey of 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine?
The InChIKey is QIPWWTIBQVLNLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN4/c1-11-3-5-6(12(2)4-11)10-7(8)9-5/h3,7,9H,4H2,1-2H3.
What are the key properties of 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine?
8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine has a molecular weight of 186.65 g/mol, XLogP of 0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-1,3-dimethyl-7,8-dihydro-2H-purine is sourced from PubChem (CID 141046225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).