C39H24F6N6S2 — CID 141046401
2-[2-[4-[2-[5-[4-(1H-benzimidazol-2-yl)-2-pyridinyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-4-pyridinyl]-1H-benzimidazole (PubChem CID 141046401) has the molecular formula C39H24F6N6S2 and a molecular weight of 754.79 g/mol. Its IUPAC name is 2-[2-[4-[2-[5-[4-(1H-benzimidazol-2-yl)-2-pyridinyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-4-pyridinyl]-1H-benzimidazole.
| Compound Name | 2-[2-[4-[2-[5-[4-(1H-benzimidazol-2-yl)-2-pyridinyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-4-pyridinyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 141046401 |
| Molecular Formula | C39H24F6N6S2 |
| Molecular Weight | 754.79 g/mol |
| Exact Mass | 754.14 |
| IUPAC Name | 2-[2-[4-[2-[5-[4-(1H-benzimidazol-2-yl)-2-pyridinyl]-2-methylthiophen-3-yl]-3,3,4,4,5,5-hexafluorocyclopenten-1-yl]-5-methylthiophen-2-yl]-4-pyridinyl]-1H-benzimidazole |
| SMILES | Cc1sc(-c2cc(-c3nc4ccccc4[nH]3)ccn2)cc1C1=C(c2cc(-c3cc(-c4nc5ccccc5[nH]4)ccn3)sc2C)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C39H24F6N6S2/c1-19-23(17-31(52-19)29-15-21(11-13-46-29)35-48-25-7-3-4-8-26(25)49-35)33-34(38(42,43)39(44,45)37(33,40)41)24-18-32(53-20(24)2)30-16-22(12-14-47-30)36-50-27-9-5-6-10-28(27)51-36/h3-18H,1-2H3,(H,48,49)(H,50,51) |
| InChIKey | YDKGXAHZSCZOSD-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.79 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|