C4H11N3 — CID 141046878
but-1-ene-1,1,4-triamine (PubChem CID 141046878) has the molecular formula C4H11N3 and a molecular weight of 101.15 g/mol. Its IUPAC name is but-1-ene-1,1,4-triamine.
| Compound Name | but-1-ene-1,1,4-triamine |
|---|---|
| PubChem CID | 141046878 |
| Molecular Formula | C4H11N3 |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.10 |
| IUPAC Name | but-1-ene-1,1,4-triamine |
| SMILES | NCCC=C(N)N |
| InChI | InChI=1S/C4H11N3/c5-3-1-2-4(6)7/h2H,1,3,5-7H2 |
| InChIKey | ZOXCVTBGVPLFML-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |