About 1,8b-dihydroindeno[2,1-b]furan-2-one
1,8b-dihydroindeno[2,1-b]furan-2-one (PubChem CID 141047089) has the molecular formula C11H8O2
and a molecular weight of 172.18 g/mol. Its IUPAC name is 1,8b-dihydroindeno[2,1-b]furan-2-one.
Molecular Properties
| Compound Name | 1,8b-dihydroindeno[2,1-b]furan-2-one |
| PubChem CID | 141047089 |
| Molecular Formula | C11H8O2 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.05 |
| IUPAC Name | 1,8b-dihydroindeno[2,1-b]furan-2-one |
| SMILES | O=C1CC2C(=Cc3ccccc32)O1 |
| InChI | InChI=1S/C11H8O2/c12-11-6-9-8-4-2-1-3-7(8)5-10(9)13-11/h1-5,9H,6H2 |
| InChIKey | BSYVSOCOIWLHMY-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8b-dihydroindeno[2,1-b]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8b-dihydroindeno[2,1-b]furan-2-one?
The IUPAC name of 1,8b-dihydroindeno[2,1-b]furan-2-one (CID 141047089) is 1,8b-dihydroindeno[2,1-b]furan-2-one.
What is the SMILES notation for 1,8b-dihydroindeno[2,1-b]furan-2-one?
The canonical SMILES for 1,8b-dihydroindeno[2,1-b]furan-2-one is O=C1CC2C(=Cc3ccccc32)O1.
What is the InChIKey of 1,8b-dihydroindeno[2,1-b]furan-2-one?
The InChIKey is BSYVSOCOIWLHMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2/c12-11-6-9-8-4-2-1-3-7(8)5-10(9)13-11/h1-5,9H,6H2.
What are the key properties of 1,8b-dihydroindeno[2,1-b]furan-2-one?
1,8b-dihydroindeno[2,1-b]furan-2-one has a molecular weight of 172.18 g/mol, XLogP of 2.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8b-dihydroindeno[2,1-b]furan-2-one is sourced from PubChem (CID 141047089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).