C10H13N3O2 — CID 141047751
3-propylpyridine-2,4-dicarboxamide (PubChem CID 141047751) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 3-propylpyridine-2,4-dicarboxamide.
| Compound Name | 3-propylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 141047751 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 3-propylpyridine-2,4-dicarboxamide |
| SMILES | CCCc1c(C(N)=O)ccnc1C(N)=O |
| InChI | InChI=1S/C10H13N3O2/c1-2-3-6-7(9(11)14)4-5-13-8(6)10(12)15/h4-5H,2-3H2,1H3,(H2,11,14)(H2,12,15) |
| InChIKey | KWCUPTVZVMQCTK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |