C9BrF19 — CID 141048736
2-bromo-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononane (PubChem CID 141048736) has the molecular formula C9BrF19 and a molecular weight of 548.96 g/mol. Its IUPAC name is 2-bromo-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononane.
| Compound Name | 2-bromo-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononane |
|---|---|
| PubChem CID | 141048736 |
| Molecular Formula | C9BrF19 |
| Molecular Weight | 548.96 g/mol |
| Exact Mass | 547.89 |
| IUPAC Name | 2-bromo-1,1,1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-nonadecafluorononane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(Br)C(F)(F)F |
| InChI | InChI=1S/C9BrF19/c10-1(11,8(24,25)26)2(12,13)3(14,15)4(16,17)5(18,19)6(20,21)7(22,23)9(27,28)29 |
| InChIKey | JPCXDJNEXPXSSP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.96 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|