C26H16O4 — CID 141049159
7-[2-(2-phenylphenyl)ethynyl]naphthalene-1,6-dicarboxylic acid (PubChem CID 141049159) has the molecular formula C26H16O4 and a molecular weight of 392.41 g/mol. Its IUPAC name is 7-[2-(2-phenylphenyl)ethynyl]naphthalene-1,6-dicarboxylic acid.
| Compound Name | 7-[2-(2-phenylphenyl)ethynyl]naphthalene-1,6-dicarboxylic acid |
|---|---|
| PubChem CID | 141049159 |
| Molecular Formula | C26H16O4 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | 7-[2-(2-phenylphenyl)ethynyl]naphthalene-1,6-dicarboxylic acid |
| SMILES | O=C(O)c1cc2cccc(C(=O)O)c2cc1C#Cc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C26H16O4/c27-25(28)22-12-6-10-19-16-24(26(29)30)20(15-23(19)22)14-13-18-9-4-5-11-21(18)17-7-2-1-3-8-17/h1-12,15-16H,(H,27,28)(H,29,30) |
| InChIKey | YGBAFYXMEIEZCD-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|