C12H18O2S4 — CID 141049385
[2-[4-[4-(hydroxymethyl)-1,3-dithiol-2-yl]butyl]-1,3-dithiol-4-yl]methanol (PubChem CID 141049385) has the molecular formula C12H18O2S4 and a molecular weight of 322.54 g/mol. Its IUPAC name is [2-[4-[4-(hydroxymethyl)-1,3-dithiol-2-yl]butyl]-1,3-dithiol-4-yl]methanol.
| Compound Name | [2-[4-[4-(hydroxymethyl)-1,3-dithiol-2-yl]butyl]-1,3-dithiol-4-yl]methanol |
|---|---|
| PubChem CID | 141049385 |
| Molecular Formula | C12H18O2S4 |
| Molecular Weight | 322.54 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [2-[4-[4-(hydroxymethyl)-1,3-dithiol-2-yl]butyl]-1,3-dithiol-4-yl]methanol |
| SMILES | OCC1=CSC(CCCCC2SC=C(CO)S2)S1 |
| InChI | InChI=1S/C12H18O2S4/c13-5-9-7-15-11(17-9)3-1-2-4-12-16-8-10(6-14)18-12/h7-8,11-14H,1-6H2 |
| InChIKey | NEKVBGGBQLKVKD-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|