C19H24O4S6 — CID 141049410
[5-methyl-2-[[4-methyl-5-(prop-2-enoyloxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methyl prop-2-enoate (PubChem CID 141049410) has the molecular formula C19H24O4S6 and a molecular weight of 508.80 g/mol. Its IUPAC name is [5-methyl-2-[[4-methyl-5-(prop-2-enoyloxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methyl prop-2-enoate.
| Compound Name | [5-methyl-2-[[4-methyl-5-(prop-2-enoyloxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methyl prop-2-enoate |
|---|---|
| PubChem CID | 141049410 |
| Molecular Formula | C19H24O4S6 |
| Molecular Weight | 508.80 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | [5-methyl-2-[[4-methyl-5-(prop-2-enoyloxymethyl)-1,3-dithiol-2-yl]methylsulfanylmethylsulfanylmethyl]-1,3-dithiol-4-yl]methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC1=C(C)SC(CSCSCC2SC(C)=C(COC(=O)C=C)S2)S1 |
| InChI | InChI=1S/C19H24O4S6/c1-5-16(20)22-7-14-12(3)26-18(28-14)9-24-11-25-10-19-27-13(4)15(29-19)8-23-17(21)6-2/h5-6,18-19H,1-2,7-11H2,3-4H3 |
| InChIKey | XMFDFDVYILHJJV-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.80 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|