About 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine
6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine (PubChem CID 141049799) has the molecular formula C13H14N2
and a molecular weight of 198.27 g/mol. Its IUPAC name is 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine |
| PubChem CID | 141049799 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1\C=CC=CC1CC1C=CC=C/C1=N\[H] |
| InChI | InChI=1S/C13H14N2/c14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1-8,10-11,14-15H,9H2/b14-12+,15-13+ |
| InChIKey | DHHPVTSXTBUDHF-QUMQEAAQSA-N |
| XLogP | 2.90 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine?
The IUPAC name of 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine (CID 141049799) is 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine?
The canonical SMILES for 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine is [H]/N=C1\C=CC=CC1CC1C=CC=C/C1=N\[H].
What is the InChIKey of 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine?
The InChIKey is DHHPVTSXTBUDHF-QUMQEAAQSA-N. The full InChI is InChI=1S/C13H14N2/c14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)15/h1-8,10-11,14-15H,9H2/b14-12+,15-13+.
What are the key properties of 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine?
6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine has a molecular weight of 198.27 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(6-iminocyclohexa-2,4-dien-1-yl)methyl]cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 141049799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).