C12H22O2S3 — CID 141050068
2-(2,4-dimethylthiolan-2-yl)sulfonyl-2,4-dimethylthiolane (PubChem CID 141050068) has the molecular formula C12H22O2S3 and a molecular weight of 294.51 g/mol. Its IUPAC name is 2-(2,4-dimethylthiolan-2-yl)sulfonyl-2,4-dimethylthiolane.
| Compound Name | 2-(2,4-dimethylthiolan-2-yl)sulfonyl-2,4-dimethylthiolane |
|---|---|
| PubChem CID | 141050068 |
| Molecular Formula | C12H22O2S3 |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-(2,4-dimethylthiolan-2-yl)sulfonyl-2,4-dimethylthiolane |
| SMILES | CC1CSC(C)(S(=O)(=O)C2(C)CC(C)CS2)C1 |
| InChI | InChI=1S/C12H22O2S3/c1-9-5-11(3,15-7-9)17(13,14)12(4)6-10(2)8-16-12/h9-10H,5-8H2,1-4H3 |
| InChIKey | OOJNPLVLGGNJSK-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |