C27H40N2O3S — CID 141050204
N-[[4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methyl]naphthalene-1-sulfonamide (PubChem CID 141050204) has the molecular formula C27H40N2O3S and a molecular weight of 472.70 g/mol. Its IUPAC name is N-[[4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methyl]naphthalene-1-sulfonamide.
| Compound Name | N-[[4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 141050204 |
| Molecular Formula | C27H40N2O3S |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | N-[[4-[6-(but-3-enylamino)hexoxy]cyclohexyl]methyl]naphthalene-1-sulfonamide |
| SMILES | C=CCCNCCCCCCOC1CCC(CNS(=O)(=O)c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C27H40N2O3S/c1-2-3-19-28-20-8-4-5-9-21-32-25-17-15-23(16-18-25)22-29-33(30,31)27-14-10-12-24-11-6-7-13-26(24)27/h2,6-7,10-14,23,25,28-29H,1,3-5,8-9,15-22H2 |
| InChIKey | XWNORARHYOPWQF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|