C20H31BrN2O2S — CID 141050230
5-bromo-N-[[4-[4-(but-3-enylamino)butoxy]cyclohexyl]methyl]thiophene-2-carboxamide (PubChem CID 141050230) has the molecular formula C20H31BrN2O2S and a molecular weight of 443.45 g/mol. Its IUPAC name is 5-bromo-N-[[4-[4-(but-3-enylamino)butoxy]cyclohexyl]methyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[[4-[4-(but-3-enylamino)butoxy]cyclohexyl]methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141050230 |
| Molecular Formula | C20H31BrN2O2S |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 5-bromo-N-[[4-[4-(but-3-enylamino)butoxy]cyclohexyl]methyl]thiophene-2-carboxamide |
| SMILES | C=CCCNCCCCOC1CCC(CNC(=O)c2ccc(Br)s2)CC1 |
| InChI | InChI=1S/C20H31BrN2O2S/c1-2-3-12-22-13-4-5-14-25-17-8-6-16(7-9-17)15-23-20(24)18-10-11-19(21)26-18/h2,10-11,16-17,22H,1,3-9,12-15H2,(H,23,24) |
| InChIKey | SZMCTHCNRGFODS-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|