About (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate
(3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate (PubChem CID 141050277) has the molecular formula C20H30F2N2O3
and a molecular weight of 384.47 g/mol. Its IUPAC name is (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate.
Molecular Properties
| Compound Name | (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate |
| PubChem CID | 141050277 |
| Molecular Formula | C20H30F2N2O3 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate |
| SMILES | CN(C)CCCCOC1CCC(CNC(=O)Oc2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C20H30F2N2O3/c1-24(2)11-3-4-12-26-16-7-5-15(6-8-16)14-23-20(25)27-17-9-10-18(21)19(22)13-17/h9-10,13,15-16H,3-8,11-12,14H2,1-2H3,(H,23,25) |
| InChIKey | WJBPSBCKZXYYCV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate?
The IUPAC name of (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate (CID 141050277) is (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate.
What is the SMILES notation for (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate?
The canonical SMILES for (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate is CN(C)CCCCOC1CCC(CNC(=O)Oc2ccc(F)c(F)c2)CC1.
What is the InChIKey of (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate?
The InChIKey is WJBPSBCKZXYYCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30F2N2O3/c1-24(2)11-3-4-12-26-16-7-5-15(6-8-16)14-23-20(25)27-17-9-10-18(21)19(22)13-17/h9-10,13,15-16H,3-8,11-12,14H2,1-2H3,(H,23,25).
What are the key properties of (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate?
(3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate has a molecular weight of 384.47 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-difluorophenyl) N-[[4-[4-(dimethylamino)butoxy]cyclohexyl]methyl]carbamate is sourced from PubChem (CID 141050277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).