C22H33ClN2O2 — CID 141050449
2-(4-chlorophenyl)-1-[4-[5-(cyclopropylmethylamino)pentoxy]piperidin-1-yl]ethanone (PubChem CID 141050449) has the molecular formula C22H33ClN2O2 and a molecular weight of 392.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[4-[5-(cyclopropylmethylamino)pentoxy]piperidin-1-yl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[4-[5-(cyclopropylmethylamino)pentoxy]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 141050449 |
| Molecular Formula | C22H33ClN2O2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[4-[5-(cyclopropylmethylamino)pentoxy]piperidin-1-yl]ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1)N1CCC(OCCCCCNCC2CC2)CC1 |
| InChI | InChI=1S/C22H33ClN2O2/c23-20-8-6-18(7-9-20)16-22(26)25-13-10-21(11-14-25)27-15-3-1-2-12-24-17-19-4-5-19/h6-9,19,21,24H,1-5,10-17H2 |
| InChIKey | YVPMJQKVWUIQDC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|