C24H23NO — CID 141050503
N-[[5-(2-methylprop-2-enyl)-2-phenylphenyl]methyl]benzamide (PubChem CID 141050503) has the molecular formula C24H23NO and a molecular weight of 341.45 g/mol. Its IUPAC name is N-[[5-(2-methylprop-2-enyl)-2-phenylphenyl]methyl]benzamide.
| Compound Name | N-[[5-(2-methylprop-2-enyl)-2-phenylphenyl]methyl]benzamide |
|---|---|
| PubChem CID | 141050503 |
| Molecular Formula | C24H23NO |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[[5-(2-methylprop-2-enyl)-2-phenylphenyl]methyl]benzamide |
| SMILES | C=C(C)Cc1ccc(-c2ccccc2)c(CNC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO/c1-18(2)15-19-13-14-23(20-9-5-3-6-10-20)22(16-19)17-25-24(26)21-11-7-4-8-12-21/h3-14,16H,1,15,17H2,2H3,(H,25,26) |
| InChIKey | MWCWFQZSQLCELC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|