C23H19NO3 — CID 141050517
N-[[3-[4-(1,3-dioxol-2-yl)phenyl]phenyl]methyl]benzamide (PubChem CID 141050517) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[[3-[4-(1,3-dioxol-2-yl)phenyl]phenyl]methyl]benzamide.
| Compound Name | N-[[3-[4-(1,3-dioxol-2-yl)phenyl]phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 141050517 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[[3-[4-(1,3-dioxol-2-yl)phenyl]phenyl]methyl]benzamide |
| SMILES | O=C(NCc1cccc(-c2ccc(C3OC=CO3)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C23H19NO3/c25-22(19-6-2-1-3-7-19)24-16-17-5-4-8-21(15-17)18-9-11-20(12-10-18)23-26-13-14-27-23/h1-15,23H,16H2,(H,24,25) |
| InChIKey | MAIUSJZSQUYGFI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |