About 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one
3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one (PubChem CID 141050614) has the molecular formula C9H12N2O2
and a molecular weight of 180.21 g/mol. Its IUPAC name is 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one.
Molecular Properties
| Compound Name | 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one |
| PubChem CID | 141050614 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one |
| SMILES | CCCc1nc2c(n1C)C(=O)OC2 |
| InChI | InChI=1S/C9H12N2O2/c1-3-4-7-10-6-5-13-9(12)8(6)11(7)2/h3-5H2,1-2H3 |
| InChIKey | JAQHTDUOYYLKIG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one?
The IUPAC name of 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one (CID 141050614) is 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one.
What is the SMILES notation for 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one?
The canonical SMILES for 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one is CCCc1nc2c(n1C)C(=O)OC2.
What is the InChIKey of 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one?
The InChIKey is JAQHTDUOYYLKIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2/c1-3-4-7-10-6-5-13-9(12)8(6)11(7)2/h3-5H2,1-2H3.
What are the key properties of 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one?
3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one has a molecular weight of 180.21 g/mol, XLogP of 1.04, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-propyl-6H-furo[3,4-d]imidazol-4-one is sourced from PubChem (CID 141050614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).