About 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride
6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride (PubChem CID 141050615) has the molecular formula C10H15ClN2O2
and a molecular weight of 230.69 g/mol. Its IUPAC name is 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride.
Molecular Properties
| Compound Name | 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride |
| PubChem CID | 141050615 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride |
| SMILES | CCCc1nc2c([nH]1)C(C)(C)OC2=O.Cl |
| InChI | InChI=1S/C10H14N2O2.ClH/c1-4-5-6-11-7-8(12-6)10(2,3)14-9(7)13;/h4-5H2,1-3H3,(H,11,12);1H |
| InChIKey | BEDCBPKQGDQHIX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride?
The IUPAC name of 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride (CID 141050615) is 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride.
What is the SMILES notation for 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride?
The canonical SMILES for 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride is CCCc1nc2c([nH]1)C(C)(C)OC2=O.Cl.
What is the InChIKey of 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride?
The InChIKey is BEDCBPKQGDQHIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2.ClH/c1-4-5-6-11-7-8(12-6)10(2,3)14-9(7)13;/h4-5H2,1-3H3,(H,11,12);1H.
What are the key properties of 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride?
6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride has a molecular weight of 230.69 g/mol, XLogP of 2.19, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-2-propyl-1H-furo[3,4-d]imidazol-4-one;hydrochloride is sourced from PubChem (CID 141050615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).