C4H10O4S2 — CID 141050867
(2S,3S)-1,4-bis(sulfanyl)butane-1,2,3,4-tetrol (PubChem CID 141050867) has the molecular formula C4H10O4S2 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2S,3S)-1,4-bis(sulfanyl)butane-1,2,3,4-tetrol.
| Compound Name | (2S,3S)-1,4-bis(sulfanyl)butane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 141050867 |
| Molecular Formula | C4H10O4S2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | (2S,3S)-1,4-bis(sulfanyl)butane-1,2,3,4-tetrol |
| SMILES | OC(S)[C@@H](O)[C@H](O)C(O)S |
| InChI | InChI=1S/C4H10O4S2/c5-1(3(7)9)2(6)4(8)10/h1-10H/t1-,2-,3?,4?/m0/s1 |
| InChIKey | MLIBNPMNPWTZHR-CMSHZVMTSA-N |
| XLogP | -1.80 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|