C24H21Cl2NO3S — CID 141051325
3-[[2-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-2-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-1H-indole (PubChem CID 141051325) has the molecular formula C24H21Cl2NO3S and a molecular weight of 474.41 g/mol. Its IUPAC name is 3-[[2-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-2-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-1H-indole.
| Compound Name | 3-[[2-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-2-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-1H-indole |
|---|---|
| PubChem CID | 141051325 |
| Molecular Formula | C24H21Cl2NO3S |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 3-[[2-(2,4-dichlorophenyl)oxiran-2-yl]methyl]-2-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-1H-indole |
| SMILES | CC1(S(=O)(=O)c2[nH]c3ccccc3c2CC2(c3ccc(Cl)cc3Cl)CO2)C=CC=CC1 |
| InChI | InChI=1S/C24H21Cl2NO3S/c1-23(11-5-2-6-12-23)31(28,29)22-18(17-7-3-4-8-21(17)27-22)14-24(15-30-24)19-10-9-16(25)13-20(19)26/h2-11,13,27H,12,14-15H2,1H3 |
| InChIKey | COFGOYVURPUEIW-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|