C9H11NO3 — CID 141051359
4-(2,2-dihydroxyethylamino)benzaldehyde (PubChem CID 141051359) has the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. Its IUPAC name is 4-(2,2-dihydroxyethylamino)benzaldehyde.
| Compound Name | 4-(2,2-dihydroxyethylamino)benzaldehyde |
|---|---|
| PubChem CID | 141051359 |
| Molecular Formula | C9H11NO3 |
| Molecular Weight | 181.19 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 4-(2,2-dihydroxyethylamino)benzaldehyde |
| SMILES | O=Cc1ccc(NCC(O)O)cc1 |
| InChI | InChI=1S/C9H11NO3/c11-6-7-1-3-8(4-2-7)10-5-9(12)13/h1-4,6,9-10,12-13H,5H2 |
| InChIKey | OTKCZGVXKXZMIJ-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|