C10H11F3N2O4 — CID 141051431
[(Z)-5-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)pent-3-enyl] 2,2,2-trifluoroacetate (PubChem CID 141051431) has the molecular formula C10H11F3N2O4 and a molecular weight of 280.20 g/mol. Its IUPAC name is [(Z)-5-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)pent-3-enyl] 2,2,2-trifluoroacetate.
| Compound Name | [(Z)-5-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)pent-3-enyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141051431 |
| Molecular Formula | C10H11F3N2O4 |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | [(Z)-5-(3-methyl-5-oxo-1,2,4-oxadiazol-4-yl)pent-3-enyl] 2,2,2-trifluoroacetate |
| SMILES | Cc1noc(=O)n1C/C=C\CCOC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O4/c1-7-14-19-9(17)15(7)5-3-2-4-6-18-8(16)10(11,12)13/h2-3H,4-6H2,1H3/b3-2- |
| InChIKey | UDZWTPYITXQICD-IHWYPQMZSA-N |
| XLogP | 1.20 |
| TPSA | 74.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|