C11H12ClNO3 — CID 141051954
(4-chlorophenyl)-(1,5,2-dioxazepan-2-yl)methanone (PubChem CID 141051954) has the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. Its IUPAC name is (4-chlorophenyl)-(1,5,2-dioxazepan-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(1,5,2-dioxazepan-2-yl)methanone |
|---|---|
| PubChem CID | 141051954 |
| Molecular Formula | C11H12ClNO3 |
| Molecular Weight | 241.67 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (4-chlorophenyl)-(1,5,2-dioxazepan-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCOCCO1 |
| InChI | InChI=1S/C11H12ClNO3/c12-10-3-1-9(2-4-10)11(14)13-5-6-15-7-8-16-13/h1-4H,5-8H2 |
| InChIKey | MVQFPLZHWQMHCE-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.67 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |