C27H40O6 — CID 141052980
5-hydroxy-2-[13-(5-hydroxy-4-oxopyran-2-yl)-2,2,12,12-tetramethyltridecyl]pyran-4-one (PubChem CID 141052980) has the molecular formula C27H40O6 and a molecular weight of 460.61 g/mol. Its IUPAC name is 5-hydroxy-2-[13-(5-hydroxy-4-oxopyran-2-yl)-2,2,12,12-tetramethyltridecyl]pyran-4-one.
| Compound Name | 5-hydroxy-2-[13-(5-hydroxy-4-oxopyran-2-yl)-2,2,12,12-tetramethyltridecyl]pyran-4-one |
|---|---|
| PubChem CID | 141052980 |
| Molecular Formula | C27H40O6 |
| Molecular Weight | 460.61 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 5-hydroxy-2-[13-(5-hydroxy-4-oxopyran-2-yl)-2,2,12,12-tetramethyltridecyl]pyran-4-one |
| SMILES | CC(C)(CCCCCCCCCC(C)(C)Cc1cc(=O)c(O)co1)Cc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C27H40O6/c1-26(2,16-20-14-22(28)24(30)18-32-20)12-10-8-6-5-7-9-11-13-27(3,4)17-21-15-23(29)25(31)19-33-21/h14-15,18-19,30-31H,5-13,16-17H2,1-4H3 |
| InChIKey | MKYKUCSQEIFZDY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.61 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|