C28H42O6 — CID 141052990
5-hydroxy-2-[14-(5-hydroxy-4-oxopyran-2-yl)-3,3,12,12-tetramethyltetradecyl]pyran-4-one (PubChem CID 141052990) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is 5-hydroxy-2-[14-(5-hydroxy-4-oxopyran-2-yl)-3,3,12,12-tetramethyltetradecyl]pyran-4-one.
| Compound Name | 5-hydroxy-2-[14-(5-hydroxy-4-oxopyran-2-yl)-3,3,12,12-tetramethyltetradecyl]pyran-4-one |
|---|---|
| PubChem CID | 141052990 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 5-hydroxy-2-[14-(5-hydroxy-4-oxopyran-2-yl)-3,3,12,12-tetramethyltetradecyl]pyran-4-one |
| SMILES | CC(C)(CCCCCCCCC(C)(C)CCc1cc(=O)c(O)co1)CCc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C28H42O6/c1-27(2,15-11-21-17-23(29)25(31)19-33-21)13-9-7-5-6-8-10-14-28(3,4)16-12-22-18-24(30)26(32)20-34-22/h17-20,31-32H,5-16H2,1-4H3 |
| InChIKey | UATSEPQMHKKAIN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|