About 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol
2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol (PubChem CID 141053024) has the molecular formula C7H6ClO3P
and a molecular weight of 204.55 g/mol. Its IUPAC name is 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol.
Molecular Properties
| Compound Name | 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol |
| PubChem CID | 141053024 |
| Molecular Formula | C7H6ClO3P |
| Molecular Weight | 204.55 g/mol |
| Exact Mass | 203.97 |
| IUPAC Name | 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol |
| SMILES | Oc1ccccc1C1OP(Cl)O1 |
| InChI | InChI=1S/C7H6ClO3P/c8-12-10-7(11-12)5-3-1-2-4-6(5)9/h1-4,7,9H |
| InChIKey | MLGACJCMXUCROH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol?
The IUPAC name of 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol (CID 141053024) is 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol.
What is the SMILES notation for 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol?
The canonical SMILES for 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol is Oc1ccccc1C1OP(Cl)O1.
What is the InChIKey of 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol?
The InChIKey is MLGACJCMXUCROH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClO3P/c8-12-10-7(11-12)5-3-1-2-4-6(5)9/h1-4,7,9H.
What are the key properties of 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol?
2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol has a molecular weight of 204.55 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-1,3,2-dioxaphosphetan-4-yl)phenol is sourced from PubChem (CID 141053024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).